C16H17NO5S2 — CID 94664257
4-methylsulfonyl-N-(3-prop-2-enoxyphenyl)benzenesulfonamide (PubChem CID 94664257) has the molecular formula C16H17NO5S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-methylsulfonyl-N-(3-prop-2-enoxyphenyl)benzenesulfonamide.
| Compound Name | 4-methylsulfonyl-N-(3-prop-2-enoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 94664257 |
| Molecular Formula | C16H17NO5S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 4-methylsulfonyl-N-(3-prop-2-enoxyphenyl)benzenesulfonamide |
| SMILES | C=CCOc1cccc(NS(=O)(=O)c2ccc(S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C16H17NO5S2/c1-3-11-22-14-6-4-5-13(12-14)17-24(20,21)16-9-7-15(8-10-16)23(2,18)19/h3-10,12,17H,1,11H2,2H3 |
| InChIKey | RKXSBSMAFKVERP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|