C16H16FNO3S — CID 100691508
4-fluoro-2-methyl-N-(3-prop-2-enoxyphenyl)benzenesulfonamide (PubChem CID 100691508) has the molecular formula C16H16FNO3S and a molecular weight of 321.37 g/mol. Its IUPAC name is 4-fluoro-2-methyl-N-(3-prop-2-enoxyphenyl)benzenesulfonamide.
| Compound Name | 4-fluoro-2-methyl-N-(3-prop-2-enoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 100691508 |
| Molecular Formula | C16H16FNO3S |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 4-fluoro-2-methyl-N-(3-prop-2-enoxyphenyl)benzenesulfonamide |
| SMILES | C=CCOc1cccc(NS(=O)(=O)c2ccc(F)cc2C)c1 |
| InChI | InChI=1S/C16H16FNO3S/c1-3-9-21-15-6-4-5-14(11-15)18-22(19,20)16-8-7-13(17)10-12(16)2/h3-8,10-11,18H,1,9H2,2H3 |
| InChIKey | MSORGSOYCNGCPY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|