About (3R)-N,N-dimethyl-3-phenyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide
(3R)-N,N-dimethyl-3-phenyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide (PubChem CID 94665026) has the molecular formula C16H17F3N4O
and a molecular weight of 338.33 g/mol. Its IUPAC name is (3R)-N,N-dimethyl-3-phenyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide.
Molecular Properties
| Compound Name | (3R)-N,N-dimethyl-3-phenyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide |
| PubChem CID | 94665026 |
| Molecular Formula | C16H17F3N4O |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (3R)-N,N-dimethyl-3-phenyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide |
| SMILES | CN(C)C(=O)C[C@@H](Nc1nccc(C(F)(F)F)n1)c1ccccc1 |
| InChI | InChI=1S/C16H17F3N4O/c1-23(2)14(24)10-12(11-6-4-3-5-7-11)21-15-20-9-8-13(22-15)16(17,18)19/h3-9,12H,10H2,1-2H3,(H,20,21,22)/t12-/m1/s1 |
| InChIKey | SRFNKZSOGXXCKC-GFCCVEGCSA-N |
| XLogP | 3.13 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-N,N-dimethyl-3-phenyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N,N-dimethyl-3-phenyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide?
The IUPAC name of (3R)-N,N-dimethyl-3-phenyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide (CID 94665026) is (3R)-N,N-dimethyl-3-phenyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide.
What is the SMILES notation for (3R)-N,N-dimethyl-3-phenyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide?
The canonical SMILES for (3R)-N,N-dimethyl-3-phenyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide is CN(C)C(=O)C[C@@H](Nc1nccc(C(F)(F)F)n1)c1ccccc1.
What is the InChIKey of (3R)-N,N-dimethyl-3-phenyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide?
The InChIKey is SRFNKZSOGXXCKC-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H17F3N4O/c1-23(2)14(24)10-12(11-6-4-3-5-7-11)21-15-20-9-8-13(22-15)16(17,18)19/h3-9,12H,10H2,1-2H3,(H,20,21,22)/t12-/m1/s1.
What are the key properties of (3R)-N,N-dimethyl-3-phenyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide?
(3R)-N,N-dimethyl-3-phenyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide has a molecular weight of 338.33 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N,N-dimethyl-3-phenyl-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide is sourced from PubChem (CID 94665026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).