C19H24F3N2O2+ — CID 9467364
(E)-1-[4-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 9467364) has the molecular formula C19H24F3N2O2+ and a molecular weight of 369.41 g/mol. Its IUPAC name is (E)-1-[4-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9467364 |
| Molecular Formula | C19H24F3N2O2+ |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (E)-1-[4-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(C(F)(F)F)c1)N1CC[NH+](C[C@@H]2CCCO2)CC1 |
| InChI | InChI=1S/C19H23F3N2O2/c20-19(21,22)16-4-1-3-15(13-16)6-7-18(25)24-10-8-23(9-11-24)14-17-5-2-12-26-17/h1,3-4,6-7,13,17H,2,5,8-12,14H2/p+1/b7-6+/t17-/m0/s1 |
| InChIKey | UFCDUDAUBBKRHI-LXXRFIIISA-O |
| XLogP | 1.62 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|