C21H18F2N2O3 — CID 94674833
6-fluoro-1-[(2-fluorophenyl)methyl]-4-oxo-7-pyrrolidin-1-ylquinoline-3-carboxylic acid (PubChem CID 94674833) has the molecular formula C21H18F2N2O3 and a molecular weight of 384.38 g/mol. Its IUPAC name is 6-fluoro-1-[(2-fluorophenyl)methyl]-4-oxo-7-pyrrolidin-1-ylquinoline-3-carboxylic acid.
| Compound Name | 6-fluoro-1-[(2-fluorophenyl)methyl]-4-oxo-7-pyrrolidin-1-ylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 94674833 |
| Molecular Formula | C21H18F2N2O3 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 6-fluoro-1-[(2-fluorophenyl)methyl]-4-oxo-7-pyrrolidin-1-ylquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(Cc2ccccc2F)c2cc(N3CCCC3)c(F)cc2c1=O |
| InChI | InChI=1S/C21H18F2N2O3/c22-16-6-2-1-5-13(16)11-25-12-15(21(27)28)20(26)14-9-17(23)19(10-18(14)25)24-7-3-4-8-24/h1-2,5-6,9-10,12H,3-4,7-8,11H2,(H,27,28) |
| InChIKey | XLKACTIIKITLCS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |