3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid

C14H16N2O3 — CID 94692581

IUPAC3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid
SMILESCCCc1ccc(-c2nnc(CCC(=O)O)o2)cc1
InChIInChI=1S/C14H16N2O3/c1-2-3-10-4-6-11(7-5-10)14-16-15-12(19-14)8-9-13(17)18/h4-7H,2-3,8-9H2,1H3,(H,17,18)
InChIKeyIGZAAFWYMVCQPQ-UHFFFAOYSA-N
MW260.29 g/mol
LogP2.71
Rot. Bonds6

About 3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid

3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid (PubChem CID 94692581) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid.

Molecular Properties

Compound Name3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid
PubChem CID94692581
Molecular FormulaC14H16N2O3
Molecular Weight260.29 g/mol
Exact Mass260.12
IUPAC Name3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid
SMILESCCCc1ccc(-c2nnc(CCC(=O)O)o2)cc1
InChIInChI=1S/C14H16N2O3/c1-2-3-10-4-6-11(7-5-10)14-16-15-12(19-14)8-9-13(17)18/h4-7H,2-3,8-9H2,1H3,(H,17,18)
InChIKeyIGZAAFWYMVCQPQ-UHFFFAOYSA-N
XLogP2.71
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.29
LogP ≤ 52.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid?
The IUPAC name of 3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid (CID 94692581) is 3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid.
What is the SMILES notation for 3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid?
The canonical SMILES for 3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid is CCCc1ccc(-c2nnc(CCC(=O)O)o2)cc1.
What is the InChIKey of 3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid?
The InChIKey is IGZAAFWYMVCQPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c1-2-3-10-4-6-11(7-5-10)14-16-15-12(19-14)8-9-13(17)18/h4-7H,2-3,8-9H2,1H3,(H,17,18).
What are the key properties of 3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid?
3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid has a molecular weight of 260.29 g/mol, XLogP of 2.71, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(4-propylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid is sourced from PubChem (CID 94692581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).