C14H21NO4 — CID 94695521
3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3,3-dimethoxypropan-1-amine (PubChem CID 94695521) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3,3-dimethoxypropan-1-amine.
| Compound Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3,3-dimethoxypropan-1-amine |
|---|---|
| PubChem CID | 94695521 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3,3-dimethoxypropan-1-amine |
| SMILES | COC(CCN)(OC)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C14H21NO4/c1-16-14(17-2,6-7-15)11-4-5-12-13(10-11)19-9-3-8-18-12/h4-5,10H,3,6-9,15H2,1-2H3 |
| InChIKey | KEHFDFVNTAXFCK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|