C23H28N4O3 — CID 9470954
4-(2-ethoxyphenoxy)-N-methyl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]butanamide (PubChem CID 9470954) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 4-(2-ethoxyphenoxy)-N-methyl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]butanamide.
| Compound Name | 4-(2-ethoxyphenoxy)-N-methyl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 9470954 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 4-(2-ethoxyphenoxy)-N-methyl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]butanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)N(C)[C@@H](C)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C23H28N4O3/c1-4-29-21-8-5-6-9-22(21)30-15-7-10-23(28)26(3)18(2)19-11-13-20(14-12-19)27-17-24-16-25-27/h5-6,8-9,11-14,16-18H,4,7,10,15H2,1-3H3/t18-/m0/s1 |
| InChIKey | YUCQRQSYIRDPOC-SFHVURJKSA-N |
| XLogP | 4.04 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|