C22H26N4O2 — CID 51201707
N-methyl-4-(3-methylphenoxy)-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]butanamide (PubChem CID 51201707) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is N-methyl-4-(3-methylphenoxy)-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]butanamide.
| Compound Name | N-methyl-4-(3-methylphenoxy)-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 51201707 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | N-methyl-4-(3-methylphenoxy)-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]butanamide |
| SMILES | Cc1cccc(OCCCC(=O)N(C)C(C)c2ccc(-n3cncn3)cc2)c1 |
| InChI | InChI=1S/C22H26N4O2/c1-17-6-4-7-21(14-17)28-13-5-8-22(27)25(3)18(2)19-9-11-20(12-10-19)26-16-23-15-24-26/h4,6-7,9-12,14-16,18H,5,8,13H2,1-3H3 |
| InChIKey | APFIOILGHYNOAP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|