C19H20N4OS — CID 9471279
(E)-N-methyl-3-(5-methylthiophen-2-yl)-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]prop-2-enamide (PubChem CID 9471279) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is (E)-N-methyl-3-(5-methylthiophen-2-yl)-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-N-methyl-3-(5-methylthiophen-2-yl)-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9471279 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (E)-N-methyl-3-(5-methylthiophen-2-yl)-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)N(C)[C@@H](C)c2ccc(-n3cncn3)cc2)s1 |
| InChI | InChI=1S/C19H20N4OS/c1-14-4-9-18(25-14)10-11-19(24)22(3)15(2)16-5-7-17(8-6-16)23-13-20-12-21-23/h4-13,15H,1-3H3/b11-10+/t15-/m0/s1 |
| InChIKey | BIGZAROCTRUMRG-NKSUMMKUSA-N |
| XLogP | 3.87 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|