C18H18N4OS — CID 9471293
(E)-N-methyl-3-thiophen-2-yl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]prop-2-enamide (PubChem CID 9471293) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is (E)-N-methyl-3-thiophen-2-yl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-N-methyl-3-thiophen-2-yl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9471293 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (E)-N-methyl-3-thiophen-2-yl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]prop-2-enamide |
| SMILES | C[C@@H](c1ccc(-n2cncn2)cc1)N(C)C(=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C18H18N4OS/c1-14(21(2)18(23)10-9-17-4-3-11-24-17)15-5-7-16(8-6-15)22-13-19-12-20-22/h3-14H,1-2H3/b10-9+/t14-/m0/s1 |
| InChIKey | LIMOYXUEFGKYCF-HBWSCVEGSA-N |
| XLogP | 3.56 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|