C20H18ClN3O3S — CID 9471874
3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]propanamide (PubChem CID 9471874) has the molecular formula C20H18ClN3O3S and a molecular weight of 415.90 g/mol. Its IUPAC name is 3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]propanamide.
| Compound Name | 3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]propanamide |
|---|---|
| PubChem CID | 9471874 |
| Molecular Formula | C20H18ClN3O3S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]propanamide |
| SMILES | N#Cc1ccccc1CSCCNC(=O)CCn1c(=O)oc2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H18ClN3O3S/c21-16-5-6-17-18(11-16)27-20(26)24(17)9-7-19(25)23-8-10-28-13-15-4-2-1-3-14(15)12-22/h1-6,11H,7-10,13H2,(H,23,25) |
| InChIKey | YRQDOVCLFYFAEJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|