C23H21FN2O2S — CID 46451070
N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-[5-(2-fluorophenyl)furan-2-yl]propanamide (PubChem CID 46451070) has the molecular formula C23H21FN2O2S and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-[5-(2-fluorophenyl)furan-2-yl]propanamide.
| Compound Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-[5-(2-fluorophenyl)furan-2-yl]propanamide |
|---|---|
| PubChem CID | 46451070 |
| Molecular Formula | C23H21FN2O2S |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-[5-(2-fluorophenyl)furan-2-yl]propanamide |
| SMILES | N#Cc1ccccc1CSCCNC(=O)CCc1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C23H21FN2O2S/c24-21-8-4-3-7-20(21)22-11-9-19(28-22)10-12-23(27)26-13-14-29-16-18-6-2-1-5-17(18)15-25/h1-9,11H,10,12-14,16H2,(H,26,27) |
| InChIKey | DTGZGYYTKWCPNW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|