C16H17N5O4S — CID 9474164
4-[methoxy(methyl)sulfamoyl]-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)benzamide (PubChem CID 9474164) has the molecular formula C16H17N5O4S and a molecular weight of 375.41 g/mol. Its IUPAC name is 4-[methoxy(methyl)sulfamoyl]-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)benzamide.
| Compound Name | 4-[methoxy(methyl)sulfamoyl]-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 9474164 |
| Molecular Formula | C16H17N5O4S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 4-[methoxy(methyl)sulfamoyl]-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)benzamide |
| SMILES | CON(C)S(=O)(=O)c1ccc(C(=O)NCc2nnc3ccccn23)cc1 |
| InChI | InChI=1S/C16H17N5O4S/c1-20(25-2)26(23,24)13-8-6-12(7-9-13)16(22)17-11-15-19-18-14-5-3-4-10-21(14)15/h3-10H,11H2,1-2H3,(H,17,22) |
| InChIKey | NSKCYKPIHZDCPB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|