C16H13N3O6S — CID 9475094
(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methyl (E)-3-(5-nitrofuran-2-yl)prop-2-enoate (PubChem CID 9475094) has the molecular formula C16H13N3O6S and a molecular weight of 375.36 g/mol. Its IUPAC name is (5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methyl (E)-3-(5-nitrofuran-2-yl)prop-2-enoate.
| Compound Name | (5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methyl (E)-3-(5-nitrofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 9475094 |
| Molecular Formula | C16H13N3O6S |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | (5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methyl (E)-3-(5-nitrofuran-2-yl)prop-2-enoate |
| SMILES | Cc1sc2nc(COC(=O)/C=C/c3ccc([N+](=O)[O-])o3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C16H13N3O6S/c1-8-9(2)26-16-14(8)15(21)17-11(18-16)7-24-13(20)6-4-10-3-5-12(25-10)19(22)23/h3-6H,7H2,1-2H3,(H,17,18,21)/b6-4+ |
| InChIKey | SPJOEDNEWXPJPK-GQCTYLIASA-N |
| XLogP | 2.86 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|