About [4-[[5,6-dimethyl-2-(2-methylpropyl)benzimidazol-1-yl]methyl]phenyl]methanamine
[4-[[5,6-dimethyl-2-(2-methylpropyl)benzimidazol-1-yl]methyl]phenyl]methanamine (PubChem CID 94756838) has the molecular formula C21H27N3
and a molecular weight of 321.47 g/mol. Its IUPAC name is [4-[[5,6-dimethyl-2-(2-methylpropyl)benzimidazol-1-yl]methyl]phenyl]methanamine.
Molecular Properties
| Compound Name | [4-[[5,6-dimethyl-2-(2-methylpropyl)benzimidazol-1-yl]methyl]phenyl]methanamine |
| PubChem CID | 94756838 |
| Molecular Formula | C21H27N3 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | [4-[[5,6-dimethyl-2-(2-methylpropyl)benzimidazol-1-yl]methyl]phenyl]methanamine |
| SMILES | Cc1cc2nc(CC(C)C)n(Cc3ccc(CN)cc3)c2cc1C |
| InChI | InChI=1S/C21H27N3/c1-14(2)9-21-23-19-10-15(3)16(4)11-20(19)24(21)13-18-7-5-17(12-22)6-8-18/h5-8,10-11,14H,9,12-13,22H2,1-4H3 |
| InChIKey | QTGQPHGGWFBNLP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[[5,6-dimethyl-2-(2-methylpropyl)benzimidazol-1-yl]methyl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[5,6-dimethyl-2-(2-methylpropyl)benzimidazol-1-yl]methyl]phenyl]methanamine?
The IUPAC name of [4-[[5,6-dimethyl-2-(2-methylpropyl)benzimidazol-1-yl]methyl]phenyl]methanamine (CID 94756838) is [4-[[5,6-dimethyl-2-(2-methylpropyl)benzimidazol-1-yl]methyl]phenyl]methanamine.
What is the SMILES notation for [4-[[5,6-dimethyl-2-(2-methylpropyl)benzimidazol-1-yl]methyl]phenyl]methanamine?
The canonical SMILES for [4-[[5,6-dimethyl-2-(2-methylpropyl)benzimidazol-1-yl]methyl]phenyl]methanamine is Cc1cc2nc(CC(C)C)n(Cc3ccc(CN)cc3)c2cc1C.
What is the InChIKey of [4-[[5,6-dimethyl-2-(2-methylpropyl)benzimidazol-1-yl]methyl]phenyl]methanamine?
The InChIKey is QTGQPHGGWFBNLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3/c1-14(2)9-21-23-19-10-15(3)16(4)11-20(19)24(21)13-18-7-5-17(12-22)6-8-18/h5-8,10-11,14H,9,12-13,22H2,1-4H3.
What are the key properties of [4-[[5,6-dimethyl-2-(2-methylpropyl)benzimidazol-1-yl]methyl]phenyl]methanamine?
[4-[[5,6-dimethyl-2-(2-methylpropyl)benzimidazol-1-yl]methyl]phenyl]methanamine has a molecular weight of 321.47 g/mol, XLogP of 4.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[5,6-dimethyl-2-(2-methylpropyl)benzimidazol-1-yl]methyl]phenyl]methanamine is sourced from PubChem (CID 94756838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).