C19H19N3O2 — CID 94757352
4-[2-(2,6-dimethoxyphenyl)benzimidazol-1-yl]butanenitrile (PubChem CID 94757352) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-[2-(2,6-dimethoxyphenyl)benzimidazol-1-yl]butanenitrile.
| Compound Name | 4-[2-(2,6-dimethoxyphenyl)benzimidazol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 94757352 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 4-[2-(2,6-dimethoxyphenyl)benzimidazol-1-yl]butanenitrile |
| SMILES | COc1cccc(OC)c1-c1nc2ccccc2n1CCCC#N |
| InChI | InChI=1S/C19H19N3O2/c1-23-16-10-7-11-17(24-2)18(16)19-21-14-8-3-4-9-15(14)22(19)13-6-5-12-20/h3-4,7-11H,5-6,13H2,1-2H3 |
| InChIKey | RXATVEBGJXYAJG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|