C19H17N3O2S — CID 18163997
3-[2-[2-(2-methoxyphenyl)-2-oxoethyl]sulfanylbenzimidazol-1-yl]propanenitrile (PubChem CID 18163997) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxyphenyl)-2-oxoethyl]sulfanylbenzimidazol-1-yl]propanenitrile.
| Compound Name | 3-[2-[2-(2-methoxyphenyl)-2-oxoethyl]sulfanylbenzimidazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 18163997 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 3-[2-[2-(2-methoxyphenyl)-2-oxoethyl]sulfanylbenzimidazol-1-yl]propanenitrile |
| SMILES | COc1ccccc1C(=O)CSc1nc2ccccc2n1CCC#N |
| InChI | InChI=1S/C19H17N3O2S/c1-24-18-10-5-2-7-14(18)17(23)13-25-19-21-15-8-3-4-9-16(15)22(19)12-6-11-20/h2-5,7-10H,6,12-13H2,1H3 |
| InChIKey | OCIYWWCRSZGWNV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |