C23H20N4OS — CID 112777954
3-[3-[2-(1-prop-2-enylbenzimidazol-2-yl)sulfanylacetyl]indol-1-yl]propanenitrile (PubChem CID 112777954) has the molecular formula C23H20N4OS and a molecular weight of 400.51 g/mol. Its IUPAC name is 3-[3-[2-(1-prop-2-enylbenzimidazol-2-yl)sulfanylacetyl]indol-1-yl]propanenitrile.
| Compound Name | 3-[3-[2-(1-prop-2-enylbenzimidazol-2-yl)sulfanylacetyl]indol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 112777954 |
| Molecular Formula | C23H20N4OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 3-[3-[2-(1-prop-2-enylbenzimidazol-2-yl)sulfanylacetyl]indol-1-yl]propanenitrile |
| SMILES | C=CCn1c(SCC(=O)c2cn(CCC#N)c3ccccc23)nc2ccccc21 |
| InChI | InChI=1S/C23H20N4OS/c1-2-13-27-21-11-6-4-9-19(21)25-23(27)29-16-22(28)18-15-26(14-7-12-24)20-10-5-3-8-17(18)20/h2-6,8-11,15H,1,7,13-14,16H2 |
| InChIKey | FEAMWNTZYGFCOI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|