C27H26N4O2S — CID 112785713
3-[3-[2-(3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanylacetyl]indol-1-yl]propanenitrile (PubChem CID 112785713) has the molecular formula C27H26N4O2S and a molecular weight of 470.60 g/mol. Its IUPAC name is 3-[3-[2-(3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanylacetyl]indol-1-yl]propanenitrile.
| Compound Name | 3-[3-[2-(3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanylacetyl]indol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 112785713 |
| Molecular Formula | C27H26N4O2S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 3-[3-[2-(3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanylacetyl]indol-1-yl]propanenitrile |
| SMILES | N#CCCn1cc(C(=O)CSc2nc3ccccc3c(=O)n2C2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C27H26N4O2S/c28-15-8-16-30-17-22(20-11-5-7-14-24(20)30)25(32)18-34-27-29-23-13-6-4-12-21(23)26(33)31(27)19-9-2-1-3-10-19/h4-7,11-14,17,19H,1-3,8-10,16,18H2 |
| InChIKey | OBWLBCKQDBSULW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 80.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |