C16H19N3O4 — CID 94758816
2-[[1-[2-(4-amino-3-methylphenoxy)ethyl]-2-oxo-3-pyridinyl]oxy]acetamide (PubChem CID 94758816) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-[[1-[2-(4-amino-3-methylphenoxy)ethyl]-2-oxo-3-pyridinyl]oxy]acetamide.
| Compound Name | 2-[[1-[2-(4-amino-3-methylphenoxy)ethyl]-2-oxo-3-pyridinyl]oxy]acetamide |
|---|---|
| PubChem CID | 94758816 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-[[1-[2-(4-amino-3-methylphenoxy)ethyl]-2-oxo-3-pyridinyl]oxy]acetamide |
| SMILES | Cc1cc(OCCn2cccc(OCC(N)=O)c2=O)ccc1N |
| InChI | InChI=1S/C16H19N3O4/c1-11-9-12(4-5-13(11)17)22-8-7-19-6-2-3-14(16(19)21)23-10-15(18)20/h2-6,9H,7-8,10,17H2,1H3,(H2,18,20) |
| InChIKey | TUOZQGIUBNTUMW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|