C18H31N3O2 — CID 94759859
5-[3-(2-morpholin-4-ylethylamino)propyl]-2-propan-2-yloxyaniline (PubChem CID 94759859) has the molecular formula C18H31N3O2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 5-[3-(2-morpholin-4-ylethylamino)propyl]-2-propan-2-yloxyaniline.
| Compound Name | 5-[3-(2-morpholin-4-ylethylamino)propyl]-2-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 94759859 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | 5-[3-(2-morpholin-4-ylethylamino)propyl]-2-propan-2-yloxyaniline |
| SMILES | CC(C)Oc1ccc(CCCNCCN2CCOCC2)cc1N |
| InChI | InChI=1S/C18H31N3O2/c1-15(2)23-18-6-5-16(14-17(18)19)4-3-7-20-8-9-21-10-12-22-13-11-21/h5-6,14-15,20H,3-4,7-13,19H2,1-2H3 |
| InChIKey | PGTSFIPTJDGYHZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|