C19H35N3O — CID 94759867
N-[3-(3-amino-4-propan-2-yloxyphenyl)propyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 94759867) has the molecular formula C19H35N3O and a molecular weight of 321.51 g/mol. Its IUPAC name is N-[3-(3-amino-4-propan-2-yloxyphenyl)propyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[3-(3-amino-4-propan-2-yloxyphenyl)propyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 94759867 |
| Molecular Formula | C19H35N3O |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.28 |
| IUPAC Name | N-[3-(3-amino-4-propan-2-yloxyphenyl)propyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNCCCc1ccc(OC(C)C)c(N)c1 |
| InChI | InChI=1S/C19H35N3O/c1-5-22(6-2)14-8-13-21-12-7-9-17-10-11-19(18(20)15-17)23-16(3)4/h10-11,15-16,21H,5-9,12-14,20H2,1-4H3 |
| InChIKey | ZGMPLPUOSFTTNC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|