C15H22O2S — CID 94770916
2-[2-(5-tert-butyl-2-methylphenyl)ethylsulfanyl]acetic acid (PubChem CID 94770916) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-[2-(5-tert-butyl-2-methylphenyl)ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-(5-tert-butyl-2-methylphenyl)ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 94770916 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-[2-(5-tert-butyl-2-methylphenyl)ethylsulfanyl]acetic acid |
| SMILES | Cc1ccc(C(C)(C)C)cc1CCSCC(=O)O |
| InChI | InChI=1S/C15H22O2S/c1-11-5-6-13(15(2,3)4)9-12(11)7-8-18-10-14(16)17/h5-6,9H,7-8,10H2,1-4H3,(H,16,17) |
| InChIKey | IUVLLFZNTNBPKA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|