C19H27N3O — CID 94783206
2-[(1R)-cyclopent-2-en-1-yl]-N-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]acetamide (PubChem CID 94783206) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is 2-[(1R)-cyclopent-2-en-1-yl]-N-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]acetamide.
| Compound Name | 2-[(1R)-cyclopent-2-en-1-yl]-N-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]acetamide |
|---|---|
| PubChem CID | 94783206 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 2-[(1R)-cyclopent-2-en-1-yl]-N-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]acetamide |
| SMILES | CC1CCN(c2ccc(CNC(=O)C[C@@H]3C=CCC3)cn2)CC1 |
| InChI | InChI=1S/C19H27N3O/c1-15-8-10-22(11-9-15)18-7-6-17(13-20-18)14-21-19(23)12-16-4-2-3-5-16/h2,4,6-7,13,15-16H,3,5,8-12,14H2,1H3,(H,21,23)/t16-/m1/s1 |
| InChIKey | GSMJRCJIYCQBED-MRXNPFEDSA-N |
| XLogP | 3.29 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|