C17H26N4O3 — CID 94796277
N-[3-[[(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl]amino]-2-methylphenyl]butanamide (PubChem CID 94796277) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[3-[[(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl]amino]-2-methylphenyl]butanamide.
| Compound Name | N-[3-[[(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl]amino]-2-methylphenyl]butanamide |
|---|---|
| PubChem CID | 94796277 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N-[3-[[(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl]amino]-2-methylphenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(N[C@H](C)C(=O)NC(=O)NCC)c1C |
| InChI | InChI=1S/C17H26N4O3/c1-5-8-15(22)20-14-10-7-9-13(11(14)3)19-12(4)16(23)21-17(24)18-6-2/h7,9-10,12,19H,5-6,8H2,1-4H3,(H,20,22)(H2,18,21,23,24)/t12-/m1/s1 |
| InChIKey | NFPRPQUWKUPIKF-GFCCVEGCSA-N |
| XLogP | 2.38 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |