C16H24N4O4 — CID 47068847
ethyl N-[3-[[1-(ethylcarbamoylamino)-1-oxopropan-2-yl]amino]-2-methylphenyl]carbamate (PubChem CID 47068847) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is ethyl N-[3-[[1-(ethylcarbamoylamino)-1-oxopropan-2-yl]amino]-2-methylphenyl]carbamate.
| Compound Name | ethyl N-[3-[[1-(ethylcarbamoylamino)-1-oxopropan-2-yl]amino]-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 47068847 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | ethyl N-[3-[[1-(ethylcarbamoylamino)-1-oxopropan-2-yl]amino]-2-methylphenyl]carbamate |
| SMILES | CCNC(=O)NC(=O)C(C)Nc1cccc(NC(=O)OCC)c1C |
| InChI | InChI=1S/C16H24N4O4/c1-5-17-15(22)20-14(21)11(4)18-12-8-7-9-13(10(12)3)19-16(23)24-6-2/h7-9,11,18H,5-6H2,1-4H3,(H,19,23)(H2,17,20,21,22) |
| InChIKey | MOUBGTMRHKXWJR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |