C18H16F2N2O3 — CID 94796342
3-[(2R)-2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-2-methylquinazolin-4-one (PubChem CID 94796342) has the molecular formula C18H16F2N2O3 and a molecular weight of 346.33 g/mol. Its IUPAC name is 3-[(2R)-2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-2-methylquinazolin-4-one.
| Compound Name | 3-[(2R)-2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 94796342 |
| Molecular Formula | C18H16F2N2O3 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 3-[(2R)-2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-2-methylquinazolin-4-one |
| SMILES | Cc1nc2ccccc2c(=O)n1C[C@H](O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H16F2N2O3/c1-11-21-15-5-3-2-4-14(15)17(24)22(11)10-16(23)12-6-8-13(9-7-12)25-18(19)20/h2-9,16,18,23H,10H2,1H3/t16-/m0/s1 |
| InChIKey | TVUWUZDOCDUHFO-INIZCTEOSA-N |
| XLogP | 3.04 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |