C17H23N3O3S — CID 94797380
(2R)-1-morpholin-4-yl-2-[[5-(pyrrolidine-1-carbonyl)-2-pyridinyl]sulfanyl]propan-1-one (PubChem CID 94797380) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is (2R)-1-morpholin-4-yl-2-[[5-(pyrrolidine-1-carbonyl)-2-pyridinyl]sulfanyl]propan-1-one.
| Compound Name | (2R)-1-morpholin-4-yl-2-[[5-(pyrrolidine-1-carbonyl)-2-pyridinyl]sulfanyl]propan-1-one |
|---|---|
| PubChem CID | 94797380 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (2R)-1-morpholin-4-yl-2-[[5-(pyrrolidine-1-carbonyl)-2-pyridinyl]sulfanyl]propan-1-one |
| SMILES | C[C@@H](Sc1ccc(C(=O)N2CCCC2)cn1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H23N3O3S/c1-13(16(21)20-8-10-23-11-9-20)24-15-5-4-14(12-18-15)17(22)19-6-2-3-7-19/h4-5,12-13H,2-3,6-11H2,1H3/t13-/m1/s1 |
| InChIKey | QBFOAIROPBBVKQ-CYBMUJFWSA-N |
| XLogP | 1.66 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |