C15H25NO — CID 94798251
(6R,10S)-10-ethyl-10-methyl-2-prop-2-ynyl-9-oxa-2-azaspiro[5.5]undecane (PubChem CID 94798251) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (6R,10S)-10-ethyl-10-methyl-2-prop-2-ynyl-9-oxa-2-azaspiro[5.5]undecane.
| Compound Name | (6R,10S)-10-ethyl-10-methyl-2-prop-2-ynyl-9-oxa-2-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 94798251 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (6R,10S)-10-ethyl-10-methyl-2-prop-2-ynyl-9-oxa-2-azaspiro[5.5]undecane |
| SMILES | C#CCN1CCC[C@]2(CCO[C@@](C)(CC)C2)C1 |
| InChI | InChI=1S/C15H25NO/c1-4-9-16-10-6-7-15(13-16)8-11-17-14(3,5-2)12-15/h1H,5-13H2,2-3H3/t14-,15+/m0/s1 |
| InChIKey | YZKWUMWYGAQFHQ-LSDHHAIUSA-N |
| XLogP | 2.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|