C18H34N2O+2 — CID 7074824
4-[(6S,10R)-10-ethyl-10-methyl-9-oxa-2-azoniaspiro[5.5]undecan-2-yl]but-2-ynyl-dimethylazanium (PubChem CID 7074824) has the molecular formula C18H34N2O+2 and a molecular weight of 294.48 g/mol. Its IUPAC name is 4-[(6S,10R)-10-ethyl-10-methyl-9-oxa-2-azoniaspiro[5.5]undecan-2-yl]but-2-ynyl-dimethylazanium.
| Compound Name | 4-[(6S,10R)-10-ethyl-10-methyl-9-oxa-2-azoniaspiro[5.5]undecan-2-yl]but-2-ynyl-dimethylazanium |
|---|---|
| PubChem CID | 7074824 |
| Molecular Formula | C18H34N2O+2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 4-[(6S,10R)-10-ethyl-10-methyl-9-oxa-2-azoniaspiro[5.5]undecan-2-yl]but-2-ynyl-dimethylazanium |
| SMILES | CC[C@]1(C)C[C@]2(CCC[NH+](CC#CC[NH+](C)C)C2)CCO1 |
| InChI | InChI=1S/C18H32N2O/c1-5-17(2)15-18(10-14-21-17)9-8-13-20(16-18)12-7-6-11-19(3)4/h5,8-16H2,1-4H3/p+2/t17-,18+/m1/s1 |
| InChIKey | YSTCJAQWGIWABF-MSOLQXFVSA-P |
| XLogP | -0.22 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|