C25H24N2O3 — CID 9479837
4-benzoyl-N-[2-(2,5-dimethylanilino)-2-oxoethyl]-N-methylbenzamide (PubChem CID 9479837) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-benzoyl-N-[2-(2,5-dimethylanilino)-2-oxoethyl]-N-methylbenzamide.
| Compound Name | 4-benzoyl-N-[2-(2,5-dimethylanilino)-2-oxoethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 9479837 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 4-benzoyl-N-[2-(2,5-dimethylanilino)-2-oxoethyl]-N-methylbenzamide |
| SMILES | Cc1ccc(C)c(NC(=O)CN(C)C(=O)c2ccc(C(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H24N2O3/c1-17-9-10-18(2)22(15-17)26-23(28)16-27(3)25(30)21-13-11-20(12-14-21)24(29)19-7-5-4-6-8-19/h4-15H,16H2,1-3H3,(H,26,28) |
| InChIKey | DIFFXOCSKXGYOR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |