C16H18ClN3OS — CID 94799215
(2S)-2-[(3-chloro-2-pyridinyl)sulfanyl]-3-methyl-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 94799215) has the molecular formula C16H18ClN3OS and a molecular weight of 335.86 g/mol. Its IUPAC name is (2S)-2-[(3-chloro-2-pyridinyl)sulfanyl]-3-methyl-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | (2S)-2-[(3-chloro-2-pyridinyl)sulfanyl]-3-methyl-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 94799215 |
| Molecular Formula | C16H18ClN3OS |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | (2S)-2-[(3-chloro-2-pyridinyl)sulfanyl]-3-methyl-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | CC(C)[C@H](Sc1ncccc1Cl)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C16H18ClN3OS/c1-11(2)14(22-16-13(17)6-4-8-19-16)15(21)20-10-12-5-3-7-18-9-12/h3-9,11,14H,10H2,1-2H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | PFTTXDICLOXFJT-AWEZNQCLSA-N |
| XLogP | 3.56 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |