C13H19NO2S — CID 94800532
2-[(R)-(2-methylphenyl)methylsulfinyl]-N-propylacetamide (PubChem CID 94800532) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-[(R)-(2-methylphenyl)methylsulfinyl]-N-propylacetamide.
| Compound Name | 2-[(R)-(2-methylphenyl)methylsulfinyl]-N-propylacetamide |
|---|---|
| PubChem CID | 94800532 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-[(R)-(2-methylphenyl)methylsulfinyl]-N-propylacetamide |
| SMILES | CCCNC(=O)C[S@](=O)Cc1ccccc1C |
| InChI | InChI=1S/C13H19NO2S/c1-3-8-14-13(15)10-17(16)9-12-7-5-4-6-11(12)2/h4-7H,3,8-10H2,1-2H3,(H,14,15)/t17-/m1/s1 |
| InChIKey | MXOVWVWFKKAPGP-QGZVFWFLSA-N |
| XLogP | 1.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |