C16H18ClNO3 — CID 94803138
5-[[[(2R)-2-(4-chlorophenyl)-2-hydroxyethyl]amino]methyl]-2-methoxyphenol (PubChem CID 94803138) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is 5-[[[(2R)-2-(4-chlorophenyl)-2-hydroxyethyl]amino]methyl]-2-methoxyphenol.
| Compound Name | 5-[[[(2R)-2-(4-chlorophenyl)-2-hydroxyethyl]amino]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 94803138 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 5-[[[(2R)-2-(4-chlorophenyl)-2-hydroxyethyl]amino]methyl]-2-methoxyphenol |
| SMILES | COc1ccc(CNC[C@H](O)c2ccc(Cl)cc2)cc1O |
| InChI | InChI=1S/C16H18ClNO3/c1-21-16-7-2-11(8-14(16)19)9-18-10-15(20)12-3-5-13(17)6-4-12/h2-8,15,18-20H,9-10H2,1H3/t15-/m0/s1 |
| InChIKey | MFVXBRBIXUTKLS-HNNXBMFYSA-N |
| XLogP | 2.88 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |