C17H18F3NO3 — CID 95260955
5-[[[(2S)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]amino]methyl]-2-methoxyphenol (PubChem CID 95260955) has the molecular formula C17H18F3NO3 and a molecular weight of 341.33 g/mol. Its IUPAC name is 5-[[[(2S)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]amino]methyl]-2-methoxyphenol.
| Compound Name | 5-[[[(2S)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]amino]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 95260955 |
| Molecular Formula | C17H18F3NO3 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 5-[[[(2S)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]amino]methyl]-2-methoxyphenol |
| SMILES | COc1ccc(CNC[C@@H](O)c2ccccc2C(F)(F)F)cc1O |
| InChI | InChI=1S/C17H18F3NO3/c1-24-16-7-6-11(8-14(16)22)9-21-10-15(23)12-4-2-3-5-13(12)17(18,19)20/h2-8,15,21-23H,9-10H2,1H3/t15-/m1/s1 |
| InChIKey | SBDISMBMJSKQIB-OAHLLOKOSA-N |
| XLogP | 3.24 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |