C14H15NO3S2 — CID 94805116
2-[2-(2-hydroxyethylsulfanylmethyl)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 94805116) has the molecular formula C14H15NO3S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethylsulfanylmethyl)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[2-(2-hydroxyethylsulfanylmethyl)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 94805116 |
| Molecular Formula | C14H15NO3S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-[2-(2-hydroxyethylsulfanylmethyl)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(-c2ccccc2CSCCO)sc1C(=O)O |
| InChI | InChI=1S/C14H15NO3S2/c1-9-12(14(17)18)20-13(15-9)11-5-3-2-4-10(11)8-19-7-6-16/h2-5,16H,6-8H2,1H3,(H,17,18) |
| InChIKey | RKAXSEJAXZSZQK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|