C15H23NO3 — CID 94809325
methyl 1-[[2-[(1S)-cyclopent-2-en-1-yl]acetyl]amino]cyclohexane-1-carboxylate (PubChem CID 94809325) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is methyl 1-[[2-[(1S)-cyclopent-2-en-1-yl]acetyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[[2-[(1S)-cyclopent-2-en-1-yl]acetyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 94809325 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | methyl 1-[[2-[(1S)-cyclopent-2-en-1-yl]acetyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)C[C@H]2C=CCC2)CCCCC1 |
| InChI | InChI=1S/C15H23NO3/c1-19-14(18)15(9-5-2-6-10-15)16-13(17)11-12-7-3-4-8-12/h3,7,12H,2,4-6,8-11H2,1H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | XYNFJVXXXVMYIB-LBPRGKRZSA-N |
| XLogP | 2.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|