C12H14BrNO2 — CID 94811517
cis-(1S,2R)-2-(4-bromophenyl)-N-ethoxycyclopropane-1-carboxamide (PubChem CID 94811517) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is cis-(1S,2R)-2-(4-bromophenyl)-N-ethoxycyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-2-(4-bromophenyl)-N-ethoxycyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 94811517 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | cis-(1S,2R)-2-(4-bromophenyl)-N-ethoxycyclopropane-1-carboxamide |
| SMILES | CCONC(=O)[C@H]1C[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H14BrNO2/c1-2-16-14-12(15)11-7-10(11)8-3-5-9(13)6-4-8/h3-6,10-11H,2,7H2,1H3,(H,14,15)/t10-,11-/m0/s1 |
| InChIKey | NNASLUQPMZPIJE-QWRGUYRKSA-N |
| XLogP | 2.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|