C15H14F2N2O3S — CID 94812462
(2S)-2-[(2,5-difluorophenyl)sulfonylamino]-2-phenylpropanamide (PubChem CID 94812462) has the molecular formula C15H14F2N2O3S and a molecular weight of 340.35 g/mol. Its IUPAC name is (2S)-2-[(2,5-difluorophenyl)sulfonylamino]-2-phenylpropanamide.
| Compound Name | (2S)-2-[(2,5-difluorophenyl)sulfonylamino]-2-phenylpropanamide |
|---|---|
| PubChem CID | 94812462 |
| Molecular Formula | C15H14F2N2O3S |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | (2S)-2-[(2,5-difluorophenyl)sulfonylamino]-2-phenylpropanamide |
| SMILES | C[C@@](NS(=O)(=O)c1cc(F)ccc1F)(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C15H14F2N2O3S/c1-15(14(18)20,10-5-3-2-4-6-10)19-23(21,22)13-9-11(16)7-8-12(13)17/h2-9,19H,1H3,(H2,18,20)/t15-/m0/s1 |
| InChIKey | ZFAXXAPHQYRHAM-HNNXBMFYSA-N |
| XLogP | 1.64 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |