C19H19N3O3 — CID 94814781
N-[(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl]-4-pyrrol-1-ylbenzamide (PubChem CID 94814781) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl]-4-pyrrol-1-ylbenzamide.
| Compound Name | N-[(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl]-4-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 94814781 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-[(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl]-4-pyrrol-1-ylbenzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(-n2cccc2)cc1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C19H19N3O3/c1-14(18(23)20-13-17-5-4-12-25-17)21-19(24)15-6-8-16(9-7-15)22-10-2-3-11-22/h2-12,14H,13H2,1H3,(H,20,23)(H,21,24)/t14-/m1/s1 |
| InChIKey | BLOLUWIUEJGXFE-CQSZACIVSA-N |
| XLogP | 2.51 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |