C17H22N2O4 — CID 94815046
[(1S,2S)-2-methoxycyclohexyl] 3-(2-oxoimidazolidin-1-yl)benzoate (PubChem CID 94815046) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is [(1S,2S)-2-methoxycyclohexyl] 3-(2-oxoimidazolidin-1-yl)benzoate.
| Compound Name | [(1S,2S)-2-methoxycyclohexyl] 3-(2-oxoimidazolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 94815046 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [(1S,2S)-2-methoxycyclohexyl] 3-(2-oxoimidazolidin-1-yl)benzoate |
| SMILES | CO[C@H]1CCCC[C@@H]1OC(=O)c1cccc(N2CCNC2=O)c1 |
| InChI | InChI=1S/C17H22N2O4/c1-22-14-7-2-3-8-15(14)23-16(20)12-5-4-6-13(11-12)19-10-9-18-17(19)21/h4-6,11,14-15H,2-3,7-10H2,1H3,(H,18,21)/t14-,15-/m0/s1 |
| InChIKey | CSKWDCPCFJAKDG-GJZGRUSLSA-N |
| XLogP | 2.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |