C17H20N2O4S — CID 94816049
(2R)-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-prop-2-enoxypropanamide (PubChem CID 94816049) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is (2R)-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-prop-2-enoxypropanamide.
| Compound Name | (2R)-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-prop-2-enoxypropanamide |
|---|---|
| PubChem CID | 94816049 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (2R)-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-prop-2-enoxypropanamide |
| SMILES | C=CCO[C@H](C)C(=O)Nc1nc(-c2cc(OC)ccc2OC)cs1 |
| InChI | InChI=1S/C17H20N2O4S/c1-5-8-23-11(2)16(20)19-17-18-14(10-24-17)13-9-12(21-3)6-7-15(13)22-4/h5-7,9-11H,1,8H2,2-4H3,(H,18,19,20)/t11-/m1/s1 |
| InChIKey | PETAIJHXTXXCEW-LLVKDONJSA-N |
| XLogP | 3.36 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|