C21H22N2O4S — CID 8873084
(2R)-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-phenoxybutanamide (PubChem CID 8873084) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is (2R)-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-phenoxybutanamide.
| Compound Name | (2R)-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-phenoxybutanamide |
|---|---|
| PubChem CID | 8873084 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (2R)-N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-phenoxybutanamide |
| SMILES | CC[C@@H](Oc1ccccc1)C(=O)Nc1nc(-c2cc(OC)ccc2OC)cs1 |
| InChI | InChI=1S/C21H22N2O4S/c1-4-18(27-14-8-6-5-7-9-14)20(24)23-21-22-17(13-28-21)16-12-15(25-2)10-11-19(16)26-3/h5-13,18H,4H2,1-3H3,(H,22,23,24)/t18-/m1/s1 |
| InChIKey | CEPAMHXGXRSGPN-GOSISDBHSA-N |
| XLogP | 4.62 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |