C18H22N4O2 — CID 94817594
2-[(1S)-cyclopent-2-en-1-yl]-N-[(1S)-2-methyl-1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl]acetamide (PubChem CID 94817594) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-N-[(1S)-2-methyl-1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl]acetamide.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[(1S)-2-methyl-1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl]acetamide |
|---|---|
| PubChem CID | 94817594 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[(1S)-2-methyl-1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propyl]acetamide |
| SMILES | CC(C)[C@H](NC(=O)C[C@H]1C=CCC1)c1nc(-c2cccnc2)no1 |
| InChI | InChI=1S/C18H22N4O2/c1-12(2)16(20-15(23)10-13-6-3-4-7-13)18-21-17(22-24-18)14-8-5-9-19-11-14/h3,5-6,8-9,11-13,16H,4,7,10H2,1-2H3,(H,20,23)/t13-,16-/m0/s1 |
| InChIKey | LOYBQDLITQWXJJ-BBRMVZONSA-N |
| XLogP | 3.30 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|