C17H18FN3O2 — CID 94813254
2-[(1S)-cyclopent-2-en-1-yl]-N-[(1S)-1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]acetamide (PubChem CID 94813254) has the molecular formula C17H18FN3O2 and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-N-[(1S)-1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]acetamide.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[(1S)-1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 94813254 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[(1S)-1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]acetamide |
| SMILES | C[C@H](NC(=O)C[C@H]1C=CCC1)c1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C17H18FN3O2/c1-11(19-15(22)10-12-4-2-3-5-12)17-20-16(21-23-17)13-6-8-14(18)9-7-13/h2,4,6-9,11-12H,3,5,10H2,1H3,(H,19,22)/t11-,12-/m0/s1 |
| InChIKey | IHGMSAHVHXANJY-RYUDHWBXSA-N |
| XLogP | 3.41 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|