C14H15FN4OS — CID 95593483
1-cyclopropyl-3-[(1R)-1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]thiourea (PubChem CID 95593483) has the molecular formula C14H15FN4OS and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(1R)-1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[(1R)-1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]thiourea |
|---|---|
| PubChem CID | 95593483 |
| Molecular Formula | C14H15FN4OS |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-cyclopropyl-3-[(1R)-1-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]thiourea |
| SMILES | C[C@@H](NC(=S)NC1CC1)c1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C14H15FN4OS/c1-8(16-14(21)17-11-6-7-11)13-18-12(19-20-13)9-2-4-10(15)5-3-9/h2-5,8,11H,6-7H2,1H3,(H2,16,17,21)/t8-/m1/s1 |
| InChIKey | HKOZZCYQDZMTSM-MRVPVSSYSA-N |
| XLogP | 2.56 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|