C22H19N3O2 — CID 9481788
N-[(1S)-1-(furan-2-yl)ethyl]-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 9481788) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[(1S)-1-(furan-2-yl)ethyl]-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-[(1S)-1-(furan-2-yl)ethyl]-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 9481788 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[(1S)-1-(furan-2-yl)ethyl]-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | C[C@H](NC(=O)c1cn(-c2ccccc2)nc1-c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C22H19N3O2/c1-16(20-13-8-14-27-20)23-22(26)19-15-25(18-11-6-3-7-12-18)24-21(19)17-9-4-2-5-10-17/h2-16H,1H3,(H,23,26)/t16-/m0/s1 |
| InChIKey | SYQFYMFZEUHBFG-INIZCTEOSA-N |
| XLogP | 4.62 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |