C16H18BrNO3 — CID 9481896
4-(4-bromophenoxy)-N-[(1S)-1-(furan-2-yl)ethyl]butanamide (PubChem CID 9481896) has the molecular formula C16H18BrNO3 and a molecular weight of 352.23 g/mol. Its IUPAC name is 4-(4-bromophenoxy)-N-[(1S)-1-(furan-2-yl)ethyl]butanamide.
| Compound Name | 4-(4-bromophenoxy)-N-[(1S)-1-(furan-2-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 9481896 |
| Molecular Formula | C16H18BrNO3 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 4-(4-bromophenoxy)-N-[(1S)-1-(furan-2-yl)ethyl]butanamide |
| SMILES | C[C@H](NC(=O)CCCOc1ccc(Br)cc1)c1ccco1 |
| InChI | InChI=1S/C16H18BrNO3/c1-12(15-4-2-11-21-15)18-16(19)5-3-10-20-14-8-6-13(17)7-9-14/h2,4,6-9,11-12H,3,5,10H2,1H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | NZUDWWJMNGVNPG-LBPRGKRZSA-N |
| XLogP | 4.08 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|