C18H22N4O2 — CID 94818960
1-[(1S)-1-[4-(carbamoylamino)phenyl]ethyl]-3-[(4-methylphenyl)methyl]urea (PubChem CID 94818960) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-[(1S)-1-[4-(carbamoylamino)phenyl]ethyl]-3-[(4-methylphenyl)methyl]urea.
| Compound Name | 1-[(1S)-1-[4-(carbamoylamino)phenyl]ethyl]-3-[(4-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 94818960 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-[(1S)-1-[4-(carbamoylamino)phenyl]ethyl]-3-[(4-methylphenyl)methyl]urea |
| SMILES | Cc1ccc(CNC(=O)N[C@@H](C)c2ccc(NC(N)=O)cc2)cc1 |
| InChI | InChI=1S/C18H22N4O2/c1-12-3-5-14(6-4-12)11-20-18(24)21-13(2)15-7-9-16(10-8-15)22-17(19)23/h3-10,13H,11H2,1-2H3,(H3,19,22,23)(H2,20,21,24)/t13-/m0/s1 |
| InChIKey | GQBOLSQPZLQBBT-ZDUSSCGKSA-N |
| XLogP | 3.05 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |